C22H24NiO2S4-4 — CID 58219100
bis((Z)-1-(2-methoxy-5-methylphenyl)prop-1-ene-1,2-dithiolate);nickel (PubChem CID 58219100) has the molecular formula C22H24NiO2S4-4 and a molecular weight of 507.39 g/mol. Its IUPAC name is bis((Z)-1-(2-methoxy-5-methylphenyl)prop-1-ene-1,2-dithiolate);nickel.
| Compound Name | bis((Z)-1-(2-methoxy-5-methylphenyl)prop-1-ene-1,2-dithiolate);nickel |
|---|---|
| PubChem CID | 58219100 |
| Molecular Formula | C22H24NiO2S4-4 |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | bis((Z)-1-(2-methoxy-5-methylphenyl)prop-1-ene-1,2-dithiolate);nickel |
| SMILES | COc1ccc(C)cc1/C([S-])=C(\C)[S-].COc1ccc(C)cc1/C([S-])=C(\C)[S-].[Ni] |
| InChI | InChI=1S/2C11H14OS2.Ni/c2*1-7-4-5-10(12-3)9(6-7)11(14)8(2)13;/h2*4-6,13-14H,1-3H3;/p-4/b2*11-8-; |
| InChIKey | JNWFWIDSHIHNRV-FGAGSVKJSA-J |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|