C19H24N6O3 — CID 58222973
11-acetyl-5-ethoxy-4,6,8,11,14,21-hexazatricyclo[14.2.2.13,7]henicosa-1(18),3(21),4,6,16,19-hexaen-15-one (PubChem CID 58222973) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 11-acetyl-5-ethoxy-4,6,8,11,14,21-hexazatricyclo[14.2.2.13,7]henicosa-1(18),3(21),4,6,16,19-hexaen-15-one.
| Compound Name | 11-acetyl-5-ethoxy-4,6,8,11,14,21-hexazatricyclo[14.2.2.13,7]henicosa-1(18),3(21),4,6,16,19-hexaen-15-one |
|---|---|
| PubChem CID | 58222973 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 11-acetyl-5-ethoxy-4,6,8,11,14,21-hexazatricyclo[14.2.2.13,7]henicosa-1(18),3(21),4,6,16,19-hexaen-15-one |
| SMILES | CCOc1nc2nc(n1)NCCN(C(C)=O)CCNC(=O)c1ccc(cc1)C2 |
| InChI | InChI=1S/C19H24N6O3/c1-3-28-19-23-16-12-14-4-6-15(7-5-14)17(27)20-8-10-25(13(2)26)11-9-21-18(22-16)24-19/h4-7H,3,8-12H2,1-2H3,(H,20,27)(H,21,22,23,24) |
| InChIKey | DYDLOLWNXQYUNG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|