C22H22N4O3 — CID 76707513
5-ethoxy-13,18-dioxa-2,4,6,26-tetrazatetracyclo[17.2.2.29,12.13,7]hexacosa-1(21),3,5,7(26),9(25),10,12(24),15,19,22-decaene (PubChem CID 76707513) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 5-ethoxy-13,18-dioxa-2,4,6,26-tetrazatetracyclo[17.2.2.29,12.13,7]hexacosa-1(21),3,5,7(26),9(25),10,12(24),15,19,22-decaene.
| Compound Name | 5-ethoxy-13,18-dioxa-2,4,6,26-tetrazatetracyclo[17.2.2.29,12.13,7]hexacosa-1(21),3,5,7(26),9(25),10,12(24),15,19,22-decaene |
|---|---|
| PubChem CID | 76707513 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 5-ethoxy-13,18-dioxa-2,4,6,26-tetrazatetracyclo[17.2.2.29,12.13,7]hexacosa-1(21),3,5,7(26),9(25),10,12(24),15,19,22-decaene |
| SMILES | CCOc1nc2nc(n1)Nc1ccc(cc1)OCC=CCOc1ccc(cc1)C2 |
| InChI | InChI=1S/C22H22N4O3/c1-2-27-22-25-20-15-16-5-9-18(10-6-16)28-13-3-4-14-29-19-11-7-17(8-12-19)23-21(24-20)26-22/h3-12H,2,13-15H2,1H3,(H,23,24,25,26) |
| InChIKey | MVLQWPIHXGZYGG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|