C23H24N4O3 — CID 159734169
6-ethoxy-15,20-dioxa-3,5,7,27-tetrazatetracyclo[19.2.2.14,8.110,14]heptacosa-1(24),4,6,8(27),10(26),11,13,17,21(25),22-decaene (PubChem CID 159734169) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 6-ethoxy-15,20-dioxa-3,5,7,27-tetrazatetracyclo[19.2.2.14,8.110,14]heptacosa-1(24),4,6,8(27),10(26),11,13,17,21(25),22-decaene.
| Compound Name | 6-ethoxy-15,20-dioxa-3,5,7,27-tetrazatetracyclo[19.2.2.14,8.110,14]heptacosa-1(24),4,6,8(27),10(26),11,13,17,21(25),22-decaene |
|---|---|
| PubChem CID | 159734169 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 6-ethoxy-15,20-dioxa-3,5,7,27-tetrazatetracyclo[19.2.2.14,8.110,14]heptacosa-1(24),4,6,8(27),10(26),11,13,17,21(25),22-decaene |
| SMILES | CCOc1nc2nc(n1)NCc1ccc(cc1)OCC=CCOc1cccc(c1)C2 |
| InChI | InChI=1S/C23H24N4O3/c1-2-28-23-26-21-15-18-6-5-7-20(14-18)30-13-4-3-12-29-19-10-8-17(9-11-19)16-24-22(25-21)27-23/h3-11,14H,2,12-13,15-16H2,1H3,(H,24,25,26,27) |
| InChIKey | WYBNGUIGUQTZIR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|