C23H24N4O3 — CID 76707506
5-ethoxy-14,19-dioxa-4,6,8,27-tetrazatetracyclo[18.2.2.210,13.13,7]heptacosa-1(22),3(27),4,6,10(26),11,13(25),16,20,23-decaene (PubChem CID 76707506) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 5-ethoxy-14,19-dioxa-4,6,8,27-tetrazatetracyclo[18.2.2.210,13.13,7]heptacosa-1(22),3(27),4,6,10(26),11,13(25),16,20,23-decaene.
| Compound Name | 5-ethoxy-14,19-dioxa-4,6,8,27-tetrazatetracyclo[18.2.2.210,13.13,7]heptacosa-1(22),3(27),4,6,10(26),11,13(25),16,20,23-decaene |
|---|---|
| PubChem CID | 76707506 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 5-ethoxy-14,19-dioxa-4,6,8,27-tetrazatetracyclo[18.2.2.210,13.13,7]heptacosa-1(22),3(27),4,6,10(26),11,13(25),16,20,23-decaene |
| SMILES | CCOc1nc2nc(n1)NCc1ccc(cc1)OCC=CCOc1ccc(cc1)C2 |
| InChI | InChI=1S/C23H24N4O3/c1-2-28-23-26-21-15-17-5-9-19(10-6-17)29-13-3-4-14-30-20-11-7-18(8-12-20)16-24-22(25-21)27-23/h3-12H,2,13-16H2,1H3,(H,24,25,26,27) |
| InChIKey | WEOPDYLYNVQWMJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|