C25H28N4O3 — CID 58223073
4-ethoxy-N,6-bis[(4-prop-2-enoxyphenyl)methyl]-1,3,5-triazin-2-amine (PubChem CID 58223073) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 4-ethoxy-N,6-bis[(4-prop-2-enoxyphenyl)methyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-N,6-bis[(4-prop-2-enoxyphenyl)methyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58223073 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 4-ethoxy-N,6-bis[(4-prop-2-enoxyphenyl)methyl]-1,3,5-triazin-2-amine |
| SMILES | C=CCOc1ccc(CNc2nc(Cc3ccc(OCC=C)cc3)nc(OCC)n2)cc1 |
| InChI | InChI=1S/C25H28N4O3/c1-4-15-31-21-11-7-19(8-12-21)17-23-27-24(29-25(28-23)30-6-3)26-18-20-9-13-22(14-10-20)32-16-5-2/h4-5,7-14H,1-2,6,15-18H2,3H3,(H,26,27,28,29) |
| InChIKey | BIYMKPXKSXWYAC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|