C14H22F2O4 — CID 58225766
[2-(1-butylcyclohexyl)oxy-2-oxoethyl] 2,2-difluoroacetate (PubChem CID 58225766) has the molecular formula C14H22F2O4 and a molecular weight of 292.32 g/mol. Its IUPAC name is [2-(1-butylcyclohexyl)oxy-2-oxoethyl] 2,2-difluoroacetate.
| Compound Name | [2-(1-butylcyclohexyl)oxy-2-oxoethyl] 2,2-difluoroacetate |
|---|---|
| PubChem CID | 58225766 |
| Molecular Formula | C14H22F2O4 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [2-(1-butylcyclohexyl)oxy-2-oxoethyl] 2,2-difluoroacetate |
| SMILES | CCCCC1(OC(=O)COC(=O)C(F)F)CCCCC1 |
| InChI | InChI=1S/C14H22F2O4/c1-2-3-7-14(8-5-4-6-9-14)20-11(17)10-19-13(18)12(15)16/h12H,2-10H2,1H3 |
| InChIKey | WXYGYTVSRIYBRG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |