About [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate
[(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate (PubChem CID 58226160) has the molecular formula C26H27NO2
and a molecular weight of 385.51 g/mol. Its IUPAC name is [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate.
Molecular Properties
| Compound Name | [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate |
| PubChem CID | 58226160 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate |
| SMILES | C/C(=N\OC(=O)C1C2CC3CC(C2)CC1C3)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C26H27NO2/c1-15(18-6-7-24-20(13-18)14-19-4-2-3-5-23(19)24)27-29-26(28)25-21-9-16-8-17(11-21)12-22(25)10-16/h2-7,13,16-17,21-22,25H,8-12,14H2,1H3/b27-15+ |
| InChIKey | FASDPICKCWHLIX-JFLMPSFJSA-N |
| XLogP | 5.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate?
The IUPAC name of [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate (CID 58226160) is [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate.
What is the SMILES notation for [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate?
The canonical SMILES for [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate is C/C(=N\OC(=O)C1C2CC3CC(C2)CC1C3)c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate?
The InChIKey is FASDPICKCWHLIX-JFLMPSFJSA-N. The full InChI is InChI=1S/C26H27NO2/c1-15(18-6-7-24-20(13-18)14-19-4-2-3-5-23(19)24)27-29-26(28)25-21-9-16-8-17(11-21)12-22(25)10-16/h2-7,13,16-17,21-22,25H,8-12,14H2,1H3/b27-15+.
What are the key properties of [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate?
[(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate has a molecular weight of 385.51 g/mol, XLogP of 5.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(9H-fluoren-2-yl)ethylideneamino] adamantane-2-carboxylate is sourced from PubChem (CID 58226160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).