C17H15ClN6 — CID 58229873
1-(11-chloro-12-phenyl-2,4,5,10,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl)-N,N-dimethylmethanamine (PubChem CID 58229873) has the molecular formula C17H15ClN6 and a molecular weight of 338.80 g/mol. Its IUPAC name is 1-(11-chloro-12-phenyl-2,4,5,10,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(11-chloro-12-phenyl-2,4,5,10,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 58229873 |
| Molecular Formula | C17H15ClN6 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-(11-chloro-12-phenyl-2,4,5,10,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1nnc2ccc3nc(Cl)c(-c4ccccc4)nc3n12 |
| InChI | InChI=1S/C17H15ClN6/c1-23(2)10-14-22-21-13-9-8-12-17(24(13)14)20-15(16(18)19-12)11-6-4-3-5-7-11/h3-9H,10H2,1-2H3 |
| InChIKey | YARUJDJWPQZWLW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |