C17H15F3N2O4S2 — CID 58237865
N-[2-[2-[(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]acetyl]phenyl]methanesulfonamide (PubChem CID 58237865) has the molecular formula C17H15F3N2O4S2 and a molecular weight of 432.45 g/mol. Its IUPAC name is N-[2-[2-[(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]acetyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[2-[(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]acetyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 58237865 |
| Molecular Formula | C17H15F3N2O4S2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | N-[2-[2-[(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]acetyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1C(=O)C/N=C(\CC(=O)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C17H15F3N2O4S2/c1-28(25,26)22-12-6-3-2-5-11(12)14(24)10-21-16(17(18,19)20)9-13(23)15-7-4-8-27-15/h2-8,22H,9-10H2,1H3/b21-16+ |
| InChIKey | YEVVXLWRWGPRRR-LTGZKZEYSA-N |
| XLogP | 3.58 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|