C31H55BO18 — CID 58241719
CID 58241719 (PubChem CID 58241719) has the molecular formula C31H55BO18 and a molecular weight of 726.57 g/mol.
| Compound Name | CID 58241719 |
|---|---|
| PubChem CID | 58241719 |
| Molecular Formula | C31H55BO18 |
| Molecular Weight | 726.57 g/mol |
| Exact Mass | 726.35 |
| IUPAC Name | — |
| SMILES | [B]C(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOC1(C(=O)O)CC(O)C(CC(C)=O)C(C(O)C(O)CO)O1 |
| InChI | InChI=1S/C31H55BO18/c1-23(34)20-24-25(35)21-31(30(39)40,50-29(24)28(38)26(36)22-33)49-19-18-48-17-16-47-15-14-46-13-12-45-11-10-44-9-8-43-7-6-42-5-4-41-3-2-27(32)37/h24-26,28-29,33,35-36,38H,2-22H2,1H3,(H,39,40) |
| InChIKey | BITMYUHQRGQEFL-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 244.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.57 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|