C18H15N3O6 — CID 58243049
2,4-bis(4-methoxyphenoxy)-5-nitropyrimidine (PubChem CID 58243049) has the molecular formula C18H15N3O6 and a molecular weight of 369.33 g/mol. Its IUPAC name is 2,4-bis(4-methoxyphenoxy)-5-nitropyrimidine.
| Compound Name | 2,4-bis(4-methoxyphenoxy)-5-nitropyrimidine |
|---|---|
| PubChem CID | 58243049 |
| Molecular Formula | C18H15N3O6 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2,4-bis(4-methoxyphenoxy)-5-nitropyrimidine |
| SMILES | COc1ccc(Oc2ncc([N+](=O)[O-])c(Oc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C18H15N3O6/c1-24-12-3-7-14(8-4-12)26-17-16(21(22)23)11-19-18(20-17)27-15-9-5-13(25-2)6-10-15/h3-11H,1-2H3 |
| InChIKey | CBACIOOXWYQSTB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 105.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|