C7H10N4OS — CID 58243933
2-amino-4-cyclopropyl-1,3-thiazole-5-carbohydrazide (PubChem CID 58243933) has the molecular formula C7H10N4OS and a molecular weight of 198.25 g/mol. Its IUPAC name is 2-amino-4-cyclopropyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-amino-4-cyclopropyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 58243933 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-amino-4-cyclopropyl-1,3-thiazole-5-carbohydrazide |
| SMILES | NNC(=O)c1sc(N)nc1C1CC1 |
| InChI | InChI=1S/C7H10N4OS/c8-7-10-4(3-1-2-3)5(13-7)6(12)11-9/h3H,1-2,9H2,(H2,8,10)(H,11,12) |
| InChIKey | GDZILPMPCXRTHU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|