C10H18N2O2 — CID 58245500
5-ethyl-1-oxa-5,8-diazaspiro[5.5]undecan-4-one (PubChem CID 58245500) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-ethyl-1-oxa-5,8-diazaspiro[5.5]undecan-4-one.
| Compound Name | 5-ethyl-1-oxa-5,8-diazaspiro[5.5]undecan-4-one |
|---|---|
| PubChem CID | 58245500 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 5-ethyl-1-oxa-5,8-diazaspiro[5.5]undecan-4-one |
| SMILES | CCN1C(=O)CCOC12CCCNC2 |
| InChI | InChI=1S/C10H18N2O2/c1-2-12-9(13)4-7-14-10(12)5-3-6-11-8-10/h11H,2-8H2,1H3 |
| InChIKey | VTGOTRGGZLLHDG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |