C7H14N2OS — CID 91336838
4-sulfanyl-1-oxa-4,9-diazaspiro[4.5]decane (PubChem CID 91336838) has the molecular formula C7H14N2OS and a molecular weight of 174.27 g/mol. Its IUPAC name is 4-sulfanyl-1-oxa-4,9-diazaspiro[4.5]decane.
| Compound Name | 4-sulfanyl-1-oxa-4,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 91336838 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 4-sulfanyl-1-oxa-4,9-diazaspiro[4.5]decane |
| SMILES | SN1CCOC12CCCNC2 |
| InChI | InChI=1S/C7H14N2OS/c11-9-4-5-10-7(9)2-1-3-8-6-7/h8,11H,1-6H2 |
| InChIKey | BTZMQCNZTYPQMA-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|