C14H17N3O4S — CID 144828045
[4-(1-oxa-4,9-diazaspiro[4.5]decan-4-ylsulfonyl)phenyl] cyanate (PubChem CID 144828045) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is [4-(1-oxa-4,9-diazaspiro[4.5]decan-4-ylsulfonyl)phenyl] cyanate.
| Compound Name | [4-(1-oxa-4,9-diazaspiro[4.5]decan-4-ylsulfonyl)phenyl] cyanate |
|---|---|
| PubChem CID | 144828045 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [4-(1-oxa-4,9-diazaspiro[4.5]decan-4-ylsulfonyl)phenyl] cyanate |
| SMILES | N#COc1ccc(S(=O)(=O)N2CCOC23CCCNC3)cc1 |
| InChI | InChI=1S/C14H17N3O4S/c15-11-20-12-2-4-13(5-3-12)22(18,19)17-8-9-21-14(17)6-1-7-16-10-14/h2-5,16H,1,6-10H2 |
| InChIKey | VDXIPTNTYHSPHH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|