C20H26N4O4 — CID 58247494
tert-butyl 4-[3-(4-methoxyphenoxy)pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 58247494) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is tert-butyl 4-[3-(4-methoxyphenoxy)pyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(4-methoxyphenoxy)pyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58247494 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | tert-butyl 4-[3-(4-methoxyphenoxy)pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | COc1ccc(Oc2nccnc2N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O4/c1-20(2,3)28-19(25)24-13-11-23(12-14-24)17-18(22-10-9-21-17)27-16-7-5-15(26-4)6-8-16/h5-10H,11-14H2,1-4H3 |
| InChIKey | LFOLQWIUWJSQBP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |