C81H75N7 — CID 58251513
5-[5-tert-butyl-2-(N-phenylanilino)phenyl]-N,N-bis[5-[5-tert-butyl-2-(N-phenylanilino)phenyl]-2-pyridinyl]pyridin-2-amine (PubChem CID 58251513) has the molecular formula C81H75N7 and a molecular weight of 1146.54 g/mol. Its IUPAC name is 5-[5-tert-butyl-2-(N-phenylanilino)phenyl]-N,N-bis[5-[5-tert-butyl-2-(N-phenylanilino)phenyl]-2-pyridinyl]pyridin-2-amine.
| Compound Name | 5-[5-tert-butyl-2-(N-phenylanilino)phenyl]-N,N-bis[5-[5-tert-butyl-2-(N-phenylanilino)phenyl]-2-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 58251513 |
| Molecular Formula | C81H75N7 |
| Molecular Weight | 1146.54 g/mol |
| Exact Mass | 1145.61 |
| IUPAC Name | 5-[5-tert-butyl-2-(N-phenylanilino)phenyl]-N,N-bis[5-[5-tert-butyl-2-(N-phenylanilino)phenyl]-2-pyridinyl]pyridin-2-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccccc2)c2ccccc2)c(-c2ccc(N(c3ccc(-c4cc(C(C)(C)C)ccc4N(c4ccccc4)c4ccccc4)cn3)c3ccc(-c4cc(C(C)(C)C)ccc4N(c4ccccc4)c4ccccc4)cn3)nc2)c1 |
| InChI | InChI=1S/C81H75N7/c1-79(2,3)61-43-46-73(85(64-28-16-10-17-29-64)65-30-18-11-19-31-65)70(52-61)58-40-49-76(82-55-58)88(77-50-41-59(56-83-77)71-53-62(80(4,5)6)44-47-74(71)86(66-32-20-12-21-33-66)67-34-22-13-23-35-67)78-51-42-60(57-84-78)72-54-63(81(7,8)9)45-48-75(72)87(68-36-24-14-25-37-68)69-38-26-15-27-39-69/h10-57H,1-9H3 |
| InChIKey | DJBYWRWYHBVWPM-UHFFFAOYSA-N |
| XLogP | 22.64 |
| TPSA | 51.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1146.54 |
| LogP ≤ 5 | 22.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |