C25H23ClN2O3 — CID 58252843
5-[3-(4-chlorophenyl)-3-oxopropyl]-2-methyl-3-(4-methylidene-2-oxocyclohexyl)quinazolin-4-one (PubChem CID 58252843) has the molecular formula C25H23ClN2O3 and a molecular weight of 434.92 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)-3-oxopropyl]-2-methyl-3-(4-methylidene-2-oxocyclohexyl)quinazolin-4-one.
| Compound Name | 5-[3-(4-chlorophenyl)-3-oxopropyl]-2-methyl-3-(4-methylidene-2-oxocyclohexyl)quinazolin-4-one |
|---|---|
| PubChem CID | 58252843 |
| Molecular Formula | C25H23ClN2O3 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 5-[3-(4-chlorophenyl)-3-oxopropyl]-2-methyl-3-(4-methylidene-2-oxocyclohexyl)quinazolin-4-one |
| SMILES | C=C1CCC(n2c(C)nc3cccc(CCC(=O)c4ccc(Cl)cc4)c3c2=O)C(=O)C1 |
| InChI | InChI=1S/C25H23ClN2O3/c1-15-6-12-21(23(30)14-15)28-16(2)27-20-5-3-4-18(24(20)25(28)31)9-13-22(29)17-7-10-19(26)11-8-17/h3-5,7-8,10-11,21H,1,6,9,12-14H2,2H3 |
| InChIKey | QQWVFEODEMJVLG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|