C22H27N3O4 — CID 58252856
tert-butyl N-[[2-methyl-3-(4-methylidene-2-oxocyclohexyl)-4-oxoquinazolin-5-yl]methyl]carbamate (PubChem CID 58252856) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is tert-butyl N-[[2-methyl-3-(4-methylidene-2-oxocyclohexyl)-4-oxoquinazolin-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-methyl-3-(4-methylidene-2-oxocyclohexyl)-4-oxoquinazolin-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 58252856 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | tert-butyl N-[[2-methyl-3-(4-methylidene-2-oxocyclohexyl)-4-oxoquinazolin-5-yl]methyl]carbamate |
| SMILES | C=C1CCC(n2c(C)nc3cccc(CNC(=O)OC(C)(C)C)c3c2=O)C(=O)C1 |
| InChI | InChI=1S/C22H27N3O4/c1-13-9-10-17(18(26)11-13)25-14(2)24-16-8-6-7-15(19(16)20(25)27)12-23-21(28)29-22(3,4)5/h6-8,17H,1,9-12H2,2-5H3,(H,23,28) |
| InChIKey | FNZNEWGSZCUMOZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|