C19H28BrNO3W — CID 58256421
1-bromo-4-ethylbenzene;tert-butyl (5R)-2,2,5-trimethyl-1,3-oxazolidin-4-ide-3-carboxylate;tungsten(2+) (PubChem CID 58256421) has the molecular formula C19H28BrNO3W and a molecular weight of 582.18 g/mol. Its IUPAC name is 1-bromo-4-ethylbenzene;tert-butyl (5R)-2,2,5-trimethyl-1,3-oxazolidin-4-ide-3-carboxylate;tungsten(2+).
| Compound Name | 1-bromo-4-ethylbenzene;tert-butyl (5R)-2,2,5-trimethyl-1,3-oxazolidin-4-ide-3-carboxylate;tungsten(2+) |
|---|---|
| PubChem CID | 58256421 |
| Molecular Formula | C19H28BrNO3W |
| Molecular Weight | 582.18 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | 1-bromo-4-ethylbenzene;tert-butyl (5R)-2,2,5-trimethyl-1,3-oxazolidin-4-ide-3-carboxylate;tungsten(2+) |
| SMILES | C[C@@H]1[CH-]N(C(=O)OC(C)(C)C)C(C)(C)O1.[CH2-]Cc1ccc(Br)cc1.[W+2] |
| InChI | InChI=1S/C11H20NO3.C8H8Br.W/c1-8-7-12(11(5,6)14-8)9(13)15-10(2,3)4;1-2-7-3-5-8(9)6-4-7;/h7-8H,1-6H3;3-6H,1-2H2;/q2*-1;+2/t8-;;/m1../s1 |
| InChIKey | QUSPFWBUOQWTMK-YCBDHFTFSA-N |
| XLogP | 5.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.18 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|