C18H24BrN3O4 — CID 71138687
tert-butyl (2S)-2-[(4-bromophenyl)methylcarbamoylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 71138687) has the molecular formula C18H24BrN3O4 and a molecular weight of 426.31 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-bromophenyl)methylcarbamoylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(4-bromophenyl)methylcarbamoylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71138687 |
| Molecular Formula | C18H24BrN3O4 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | tert-butyl (2S)-2-[(4-bromophenyl)methylcarbamoylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)NC(=O)NCc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H24BrN3O4/c1-18(2,3)26-17(25)22-10-4-5-14(22)15(23)21-16(24)20-11-12-6-8-13(19)9-7-12/h6-9,14H,4-5,10-11H2,1-3H3,(H2,20,21,23,24)/t14-/m0/s1 |
| InChIKey | DIMSFHATFVRCQR-AWEZNQCLSA-N |
| XLogP | 3.17 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |