C22H24FN3O4S — CID 58256852
N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-5-pyridin-2-ylthiophene-2-carboxamide (PubChem CID 58256852) has the molecular formula C22H24FN3O4S and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-5-pyridin-2-ylthiophene-2-carboxamide.
| Compound Name | N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-5-pyridin-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 58256852 |
| Molecular Formula | C22H24FN3O4S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-5-pyridin-2-ylthiophene-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(-c2ccccn2)s1)C(=O)N1C[C@H](F)[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C22H24FN3O4S/c1-12(2)9-15(22(29)26-10-13(23)20-19(26)16(27)11-30-20)25-21(28)18-7-6-17(31-18)14-5-3-4-8-24-14/h3-8,12-13,15,19-20H,9-11H2,1-2H3,(H,25,28)/t13-,15-,19+,20+/m0/s1 |
| InChIKey | HWOVVNJBOWPPNU-DZXDFRQDSA-N |
| XLogP | 2.47 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |