C29H36FN3O5S — CID 58256897
N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-[5-(1-morpholin-4-ylethyl)thiophen-2-yl]benzamide (PubChem CID 58256897) has the molecular formula C29H36FN3O5S and a molecular weight of 557.69 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-[5-(1-morpholin-4-ylethyl)thiophen-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-[5-(1-morpholin-4-ylethyl)thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 58256897 |
| Molecular Formula | C29H36FN3O5S |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-[5-(1-morpholin-4-ylethyl)thiophen-2-yl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(-c2ccc(C(C)N3CCOCC3)s2)cc1)C(=O)N1C[C@H](F)[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C29H36FN3O5S/c1-17(2)14-22(29(36)33-15-21(30)27-26(33)23(34)16-38-27)31-28(35)20-6-4-19(5-7-20)25-9-8-24(39-25)18(3)32-10-12-37-13-11-32/h4-9,17-18,21-22,26-27H,10-16H2,1-3H3,(H,31,35)/t18?,21-,22-,26+,27+/m0/s1 |
| InChIKey | IUTJVFMHAKRDJL-ZZPDRZFUSA-N |
| XLogP | 3.47 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |