C22H17FN4 — CID 58259259
4-ethynyl-3-[[6-[2-(5-fluoro-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58259259) has the molecular formula C22H17FN4 and a molecular weight of 356.40 g/mol. Its IUPAC name is 4-ethynyl-3-[[6-[2-(5-fluoro-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-ethynyl-3-[[6-[2-(5-fluoro-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58259259 |
| Molecular Formula | C22H17FN4 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-ethynyl-3-[[6-[2-(5-fluoro-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C#Cc1ccnc2[nH]cc(Cc3ccc(CCc4cncc(F)c4)nc3)c12 |
| InChI | InChI=1S/C22H17FN4/c1-2-17-7-8-25-22-21(17)18(13-27-22)9-15-3-5-20(26-12-15)6-4-16-10-19(23)14-24-11-16/h1,3,5,7-8,10-14H,4,6,9H2,(H,25,27) |
| InChIKey | HVARNAQUZDZSOT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|