C27H42F2N4O6 — CID 58263079
tert-butyl N-[1-(4,4-difluorocyclohexyl)-2-[2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 58263079) has the molecular formula C27H42F2N4O6 and a molecular weight of 556.65 g/mol. Its IUPAC name is tert-butyl N-[1-(4,4-difluorocyclohexyl)-2-[2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[1-(4,4-difluorocyclohexyl)-2-[2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58263079 |
| Molecular Formula | C27H42F2N4O6 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | tert-butyl N-[1-(4,4-difluorocyclohexyl)-2-[2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)C1CCCN1C(=O)C(NC(=O)OC(C)(C)C)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C27H42F2N4O6/c1-6-9-18(21(34)23(36)30-15-7-2)31-22(35)19-10-8-16-33(19)24(37)20(32-25(38)39-26(3,4)5)17-11-13-27(28,29)14-12-17/h7,17-20H,2,6,8-16H2,1,3-5H3,(H,30,36)(H,31,35)(H,32,38) |
| InChIKey | MKSFMUKRALAZJK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|