C32H52N4O6 — CID 58263135
(4S)-5-[(2S)-2-cyclohexyl-2-(3,3-dimethylbutanoylamino)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxamide (PubChem CID 58263135) has the molecular formula C32H52N4O6 and a molecular weight of 588.79 g/mol. Its IUPAC name is (4S)-5-[(2S)-2-cyclohexyl-2-(3,3-dimethylbutanoylamino)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxamide.
| Compound Name | (4S)-5-[(2S)-2-cyclohexyl-2-(3,3-dimethylbutanoylamino)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 58263135 |
| Molecular Formula | C32H52N4O6 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.39 |
| IUPAC Name | (4S)-5-[(2S)-2-cyclohexyl-2-(3,3-dimethylbutanoylamino)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)[C@@H]1C2CC(C)(C)OC2CN1C(=O)[C@@H](NC(=O)CC(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C32H52N4O6/c1-8-13-22(27(38)29(40)33-16-9-2)34-28(39)26-21-17-32(6,7)42-23(21)19-36(26)30(41)25(20-14-11-10-12-15-20)35-24(37)18-31(3,4)5/h9,20-23,25-26H,2,8,10-19H2,1,3-7H3,(H,33,40)(H,34,39)(H,35,37)/t21?,22?,23?,25-,26-/m0/s1 |
| InChIKey | MFXSZJZNWQUVIB-CRNJPPFSSA-N |
| XLogP | 3.04 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|