C29H46N4O7 — CID 58606346
tert-butyl N-[(1S)-2-[(4S)-4-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 58606346) has the molecular formula C29H46N4O7 and a molecular weight of 562.71 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(4S)-4-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(4S)-4-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58606346 |
| Molecular Formula | C29H46N4O7 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.34 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(4S)-4-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)N1CC2OC(C)(C)CC2[C@H]1C(=O)NC(CC1CC1)C(=O)C(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C29H46N4O7/c1-28(2,3)40-27(38)32-21(17-9-7-6-8-10-17)26(37)33-15-20-18(14-29(4,5)39-20)22(33)25(36)31-19(13-16-11-12-16)23(34)24(30)35/h16-22H,6-15H2,1-5H3,(H2,30,35)(H,31,36)(H,32,38)/t18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | MOEDHVLVOPYLTB-IOHZUATHSA-N |
| XLogP | 2.19 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|