C26H42N4O6 — CID 58263255
tert-butyl N-[(2S)-1-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 58263255) has the molecular formula C26H42N4O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 58263255 |
| Molecular Formula | C26H42N4O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C=CCCC(NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)CC)C(=O)C(=O)NCC=C |
| InChI | InChI=1S/C26H42N4O6/c1-8-11-13-18(21(31)23(33)27-15-9-2)28-22(32)19-14-12-16-30(19)24(34)20(17(4)10-3)29-25(35)36-26(5,6)7/h8-9,17-20H,1-2,10-16H2,3-7H3,(H,27,33)(H,28,32)(H,29,35)/t17?,18?,19-,20-/m0/s1 |
| InChIKey | XGZCAUXYBYVXRG-GUMHCPJTSA-N |
| XLogP | 2.24 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|