C22H28FN3OSi — CID 58265208
tert-butyl-dimethyl-[1,1,2,2-tetradeuterio-2-[3-(4-fluorophenyl)-4-pyridin-4-ylpyrazol-1-yl]ethoxy]silane (PubChem CID 58265208) has the molecular formula C22H28FN3OSi and a molecular weight of 401.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1,1,2,2-tetradeuterio-2-[3-(4-fluorophenyl)-4-pyridin-4-ylpyrazol-1-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[1,1,2,2-tetradeuterio-2-[3-(4-fluorophenyl)-4-pyridin-4-ylpyrazol-1-yl]ethoxy]silane |
|---|---|
| PubChem CID | 58265208 |
| Molecular Formula | C22H28FN3OSi |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | tert-butyl-dimethyl-[1,1,2,2-tetradeuterio-2-[3-(4-fluorophenyl)-4-pyridin-4-ylpyrazol-1-yl]ethoxy]silane |
| SMILES | [2H]C([2H])(O[Si](C)(C)C(C)(C)C)C([2H])([2H])n1cc(-c2ccncc2)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H28FN3OSi/c1-22(2,3)28(4,5)27-15-14-26-16-20(17-10-12-24-13-11-17)21(25-26)18-6-8-19(23)9-7-18/h6-13,16H,14-15H2,1-5H3/i14D2,15D2 |
| InChIKey | APUHKLLWZLLVAX-QZPARXMSSA-N |
| XLogP | 5.77 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|