C18H24NO4PS2 — CID 58265986
2-[5-(diethoxyphosphorylmethylsulfanyl)-1,3-thiazol-2-yl]-1-(3,5-dimethylphenyl)ethanone (PubChem CID 58265986) has the molecular formula C18H24NO4PS2 and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-[5-(diethoxyphosphorylmethylsulfanyl)-1,3-thiazol-2-yl]-1-(3,5-dimethylphenyl)ethanone.
| Compound Name | 2-[5-(diethoxyphosphorylmethylsulfanyl)-1,3-thiazol-2-yl]-1-(3,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 58265986 |
| Molecular Formula | C18H24NO4PS2 |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[5-(diethoxyphosphorylmethylsulfanyl)-1,3-thiazol-2-yl]-1-(3,5-dimethylphenyl)ethanone |
| SMILES | CCOP(=O)(CSc1cnc(CC(=O)c2cc(C)cc(C)c2)s1)OCC |
| InChI | InChI=1S/C18H24NO4PS2/c1-5-22-24(21,23-6-2)12-25-18-11-19-17(26-18)10-16(20)15-8-13(3)7-14(4)9-15/h7-9,11H,5-6,10,12H2,1-4H3 |
| InChIKey | YPMHJEZEQKNEJQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|