C18H9F3N4O — CID 58266677
12-[3-(trifluoromethoxy)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58266677) has the molecular formula C18H9F3N4O and a molecular weight of 354.29 g/mol. Its IUPAC name is 12-[3-(trifluoromethoxy)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-[3-(trifluoromethoxy)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58266677 |
| Molecular Formula | C18H9F3N4O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 12-[3-(trifluoromethoxy)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(-c3cccc(OC(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C18H9F3N4O/c19-18(20,21)26-13-3-1-2-10(4-13)11-5-15-14-6-12(7-22)23-9-16(14)25-17(15)24-8-11/h1-6,8-9H,(H,24,25) |
| InChIKey | MVSFMPICTIJHRH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |