C24H26FN7O2 — CID 58268918
3-[2-(4-ethenoxybutoxy)-6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrimidin-4-yl]pyrazolo[1,5-a]pyrimidin-2-amine (PubChem CID 58268918) has the molecular formula C24H26FN7O2 and a molecular weight of 463.52 g/mol. Its IUPAC name is 3-[2-(4-ethenoxybutoxy)-6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrimidin-4-yl]pyrazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 3-[2-(4-ethenoxybutoxy)-6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrimidin-4-yl]pyrazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58268918 |
| Molecular Formula | C24H26FN7O2 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 3-[2-(4-ethenoxybutoxy)-6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrimidin-4-yl]pyrazolo[1,5-a]pyrimidin-2-amine |
| SMILES | C=COCCCCOc1nc(N[C@@H](C)c2ccc(F)cc2)cc(-c2c(N)nn3cccnc23)n1 |
| InChI | InChI=1S/C24H26FN7O2/c1-3-33-13-4-5-14-34-24-29-19(21-22(26)31-32-12-6-11-27-23(21)32)15-20(30-24)28-16(2)17-7-9-18(25)10-8-17/h3,6-12,15-16H,1,4-5,13-14H2,2H3,(H2,26,31)(H,28,29,30)/t16-/m0/s1 |
| InChIKey | RCWZVKMGAOJQTB-INIZCTEOSA-N |
| XLogP | 4.40 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|