About (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate
(2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate (PubChem CID 58270760) has the molecular formula C21H22N4O2
and a molecular weight of 362.43 g/mol. Its IUPAC name is (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate |
| PubChem CID | 58270760 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate |
| SMILES | Cc1ncccc1OC(=O)N1CCC(C2=NC(c3ccccc3)=NC2)CC1 |
| InChI | InChI=1S/C21H22N4O2/c1-15-19(8-5-11-22-15)27-21(26)25-12-9-16(10-13-25)18-14-23-20(24-18)17-6-3-2-4-7-17/h2-8,11,16H,9-10,12-14H2,1H3 |
| InChIKey | ULXXWVLHOZSQDZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate?
The IUPAC name of (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate (CID 58270760) is (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate.
What is the SMILES notation for (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate?
The canonical SMILES for (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate is Cc1ncccc1OC(=O)N1CCC(C2=NC(c3ccccc3)=NC2)CC1.
What is the InChIKey of (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate?
The InChIKey is ULXXWVLHOZSQDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O2/c1-15-19(8-5-11-22-15)27-21(26)25-12-9-16(10-13-25)18-14-23-20(24-18)17-6-3-2-4-7-17/h2-8,11,16H,9-10,12-14H2,1H3.
What are the key properties of (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate?
(2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate has a molecular weight of 362.43 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate is sourced from PubChem (CID 58270760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).