C21H22N4O2 — CID 58270760
(2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate (PubChem CID 58270760) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate.
| Compound Name | (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58270760 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (2-methyl-3-pyridinyl) 4-(2-phenyl-4H-imidazol-5-yl)piperidine-1-carboxylate |
| SMILES | Cc1ncccc1OC(=O)N1CCC(C2=NC(c3ccccc3)=NC2)CC1 |
| InChI | InChI=1S/C21H22N4O2/c1-15-19(8-5-11-22-15)27-21(26)25-12-9-16(10-13-25)18-14-23-20(24-18)17-6-3-2-4-7-17/h2-8,11,16H,9-10,12-14H2,1H3 |
| InChIKey | ULXXWVLHOZSQDZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |