About (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate
(2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate (PubChem CID 58270804) has the molecular formula C22H22F2N4O2
and a molecular weight of 412.44 g/mol. Its IUPAC name is (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate |
| PubChem CID | 58270804 |
| Molecular Formula | C22H22F2N4O2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCC(C3=NC(c4cc(F)cc(F)c4)=NC3)CC2)c(C)n1 |
| InChI | InChI=1S/C22H22F2N4O2/c1-13-3-4-20(14(2)26-13)30-22(29)28-7-5-15(6-8-28)19-12-25-21(27-19)16-9-17(23)11-18(24)10-16/h3-4,9-11,15H,5-8,12H2,1-2H3 |
| InChIKey | WXBSJNCZLCGARD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate?
The IUPAC name of (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate (CID 58270804) is (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate.
What is the SMILES notation for (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate?
The canonical SMILES for (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate is Cc1ccc(OC(=O)N2CCC(C3=NC(c4cc(F)cc(F)c4)=NC3)CC2)c(C)n1.
What is the InChIKey of (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate?
The InChIKey is WXBSJNCZLCGARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F2N4O2/c1-13-3-4-20(14(2)26-13)30-22(29)28-7-5-15(6-8-28)19-12-25-21(27-19)16-9-17(23)11-18(24)10-16/h3-4,9-11,15H,5-8,12H2,1-2H3.
What are the key properties of (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate?
(2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate has a molecular weight of 412.44 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethyl-3-pyridinyl) 4-[2-(3,5-difluorophenyl)-4H-imidazol-5-yl]piperidine-1-carboxylate is sourced from PubChem (CID 58270804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).