C16H15F3N2O3 — CID 58271061
ethyl 4-(2-amino-2-oxoethyl)-1-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate (PubChem CID 58271061) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is ethyl 4-(2-amino-2-oxoethyl)-1-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 4-(2-amino-2-oxoethyl)-1-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 58271061 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | ethyl 4-(2-amino-2-oxoethyl)-1-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(C(F)(F)F)cc2)cc1CC(N)=O |
| InChI | InChI=1S/C16H15F3N2O3/c1-2-24-15(23)13-9-21(8-10(13)7-14(20)22)12-5-3-11(4-6-12)16(17,18)19/h3-6,8-9H,2,7H2,1H3,(H2,20,22) |
| InChIKey | IHGURRJTGQNFFY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |