C17H18F3NO2 — CID 57435117
ethyl 3-methyl-4-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrrole-2-carboxylate (PubChem CID 57435117) has the molecular formula C17H18F3NO2 and a molecular weight of 325.33 g/mol. Its IUPAC name is ethyl 3-methyl-4-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-methyl-4-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 57435117 |
| Molecular Formula | C17H18F3NO2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethyl 3-methyl-4-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc(CCc2ccc(C(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C17H18F3NO2/c1-3-23-16(22)15-11(2)13(10-21-15)7-4-12-5-8-14(9-6-12)17(18,19)20/h5-6,8-10,21H,3-4,7H2,1-2H3 |
| InChIKey | HTHQDSYNBXFSQE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |