C26H35NO4 — CID 58271608
decyl 3-[4-(2,5-dioxo-3-prop-2-enylpyrrolidin-1-yl)phenyl]prop-2-enoate (PubChem CID 58271608) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is decyl 3-[4-(2,5-dioxo-3-prop-2-enylpyrrolidin-1-yl)phenyl]prop-2-enoate.
| Compound Name | decyl 3-[4-(2,5-dioxo-3-prop-2-enylpyrrolidin-1-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58271608 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | decyl 3-[4-(2,5-dioxo-3-prop-2-enylpyrrolidin-1-yl)phenyl]prop-2-enoate |
| SMILES | C=CCC1CC(=O)N(c2ccc(C=CC(=O)OCCCCCCCCCC)cc2)C1=O |
| InChI | InChI=1S/C26H35NO4/c1-3-5-6-7-8-9-10-11-19-31-25(29)18-15-21-13-16-23(17-14-21)27-24(28)20-22(12-4-2)26(27)30/h4,13-18,22H,2-3,5-12,19-20H2,1H3 |
| InChIKey | VDPTWKKPZZAXLO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|