C14H20N4O9 — CID 58271903
2-[[2-[[1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]-2-oxoethoxy]methoxy]acetamide (PubChem CID 58271903) has the molecular formula C14H20N4O9 and a molecular weight of 388.33 g/mol. Its IUPAC name is 2-[[2-[[1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]-2-oxoethoxy]methoxy]acetamide.
| Compound Name | 2-[[2-[[1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]-2-oxoethoxy]methoxy]acetamide |
|---|---|
| PubChem CID | 58271903 |
| Molecular Formula | C14H20N4O9 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-[[2-[[1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]-2-oxoethoxy]methoxy]acetamide |
| SMILES | NC(=O)COCOCC(=O)Nc1ccn([C@@H]2O[C@H](CO)C(O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C14H20N4O9/c15-8(20)4-25-6-26-5-10(21)16-9-1-2-18(14(24)17-9)13-12(23)11(22)7(3-19)27-13/h1-2,7,11-13,19,22-23H,3-6H2,(H2,15,20)(H,16,17,21,24)/t7-,11?,12+,13-/m1/s1 |
| InChIKey | QNIZDQZAMKTTAD-SRDPFQNMSA-N |
| XLogP | -3.73 |
| TPSA | 195.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|