C28H24FN3O4 — CID 58272524
N-[4-[4-(3-cyclopropyl-2-oxopropyl)-3-fluorophenoxy]-7-(pyridin-2-ylmethoxy)quinolin-6-yl]formamide (PubChem CID 58272524) has the molecular formula C28H24FN3O4 and a molecular weight of 485.52 g/mol. Its IUPAC name is N-[4-[4-(3-cyclopropyl-2-oxopropyl)-3-fluorophenoxy]-7-(pyridin-2-ylmethoxy)quinolin-6-yl]formamide.
| Compound Name | N-[4-[4-(3-cyclopropyl-2-oxopropyl)-3-fluorophenoxy]-7-(pyridin-2-ylmethoxy)quinolin-6-yl]formamide |
|---|---|
| PubChem CID | 58272524 |
| Molecular Formula | C28H24FN3O4 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-[4-[4-(3-cyclopropyl-2-oxopropyl)-3-fluorophenoxy]-7-(pyridin-2-ylmethoxy)quinolin-6-yl]formamide |
| SMILES | O=CNc1cc2c(Oc3ccc(CC(=O)CC4CC4)c(F)c3)ccnc2cc1OCc1ccccn1 |
| InChI | InChI=1S/C28H24FN3O4/c29-24-13-22(7-6-19(24)12-21(34)11-18-4-5-18)36-27-8-10-31-25-15-28(26(32-17-33)14-23(25)27)35-16-20-3-1-2-9-30-20/h1-3,6-10,13-15,17-18H,4-5,11-12,16H2,(H,32,33) |
| InChIKey | FKNZBCHKUZQVAO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|