C26H25FN4O3 — CID 58272699
4-[4-[(2-cyclopropylacetyl)-methylamino]-3-fluorophenoxy]-N-(2-isocyanoethyl)-7-methylquinoline-6-carboxamide (PubChem CID 58272699) has the molecular formula C26H25FN4O3 and a molecular weight of 460.51 g/mol. Its IUPAC name is 4-[4-[(2-cyclopropylacetyl)-methylamino]-3-fluorophenoxy]-N-(2-isocyanoethyl)-7-methylquinoline-6-carboxamide.
| Compound Name | 4-[4-[(2-cyclopropylacetyl)-methylamino]-3-fluorophenoxy]-N-(2-isocyanoethyl)-7-methylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 58272699 |
| Molecular Formula | C26H25FN4O3 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 4-[4-[(2-cyclopropylacetyl)-methylamino]-3-fluorophenoxy]-N-(2-isocyanoethyl)-7-methylquinoline-6-carboxamide |
| SMILES | [C-]#[N+]CCNC(=O)c1cc2c(Oc3ccc(N(C)C(=O)CC4CC4)c(F)c3)ccnc2cc1C |
| InChI | InChI=1S/C26H25FN4O3/c1-16-12-22-20(15-19(16)26(33)30-11-10-28-2)24(8-9-29-22)34-18-6-7-23(21(27)14-18)31(3)25(32)13-17-4-5-17/h6-9,12,14-15,17H,4-5,10-11,13H2,1,3H3,(H,30,33) |
| InChIKey | BLBWQZRTKRXISG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|