C25H31F3N8O — CID 58277689
1-[(2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]-2-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]ethanone (PubChem CID 58277689) has the molecular formula C25H31F3N8O and a molecular weight of 516.57 g/mol. Its IUPAC name is 1-[(2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]-2-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]ethanone.
| Compound Name | 1-[(2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]-2-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]ethanone |
|---|---|
| PubChem CID | 58277689 |
| Molecular Formula | C25H31F3N8O |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 1-[(2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]-2-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]ethanone |
| SMILES | O=C(CC1CCCN(CC(F)(F)F)C1)[C@@H]1CCCN1c1nc(Nc2cc(C3CC3)[nH]n2)c2cccn2n1 |
| InChI | InChI=1S/C25H31F3N8O/c26-25(27,28)15-34-9-1-4-16(14-34)12-21(37)19-5-2-10-35(19)24-30-23(20-6-3-11-36(20)33-24)29-22-13-18(31-32-22)17-7-8-17/h3,6,11,13,16-17,19H,1-2,4-5,7-10,12,14-15H2,(H2,29,30,31,32,33)/t16?,19-/m0/s1 |
| InChIKey | YHDAYOIYHKEEJU-CVMIBEPCSA-N |
| XLogP | 4.28 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |