C21H22N8O2S — CID 58277732
1-[(2S)-1-[4-[[5-(1-hydroxycyclopropyl)-1H-pyrazol-3-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 58277732) has the molecular formula C21H22N8O2S and a molecular weight of 450.53 g/mol. Its IUPAC name is 1-[(2S)-1-[4-[[5-(1-hydroxycyclopropyl)-1H-pyrazol-3-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]-2-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-[(2S)-1-[4-[[5-(1-hydroxycyclopropyl)-1H-pyrazol-3-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]-2-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 58277732 |
| Molecular Formula | C21H22N8O2S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 1-[(2S)-1-[4-[[5-(1-hydroxycyclopropyl)-1H-pyrazol-3-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyrrolidin-2-yl]-2-(1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(Cc1nccs1)[C@@H]1CCCN1c1nc(Nc2cc(C3(O)CC3)[nH]n2)c2cccn2n1 |
| InChI | InChI=1S/C21H22N8O2S/c30-15(11-18-22-7-10-32-18)13-3-1-8-28(13)20-24-19(14-4-2-9-29(14)27-20)23-17-12-16(25-26-17)21(31)5-6-21/h2,4,7,9-10,12-13,31H,1,3,5-6,8,11H2,(H2,23,24,25,26,27)/t13-/m0/s1 |
| InChIKey | BSHUVAHDAKVKBR-ZDUSSCGKSA-N |
| XLogP | 2.41 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |