C9H9ClF3N3O2 — CID 58278401
ethyl 2-[2-amino-4-chloro-6-(trifluoromethyl)pyrimidin-5-yl]acetate (PubChem CID 58278401) has the molecular formula C9H9ClF3N3O2 and a molecular weight of 283.64 g/mol. Its IUPAC name is ethyl 2-[2-amino-4-chloro-6-(trifluoromethyl)pyrimidin-5-yl]acetate.
| Compound Name | ethyl 2-[2-amino-4-chloro-6-(trifluoromethyl)pyrimidin-5-yl]acetate |
|---|---|
| PubChem CID | 58278401 |
| Molecular Formula | C9H9ClF3N3O2 |
| Molecular Weight | 283.64 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | ethyl 2-[2-amino-4-chloro-6-(trifluoromethyl)pyrimidin-5-yl]acetate |
| SMILES | CCOC(=O)Cc1c(Cl)nc(N)nc1C(F)(F)F |
| InChI | InChI=1S/C9H9ClF3N3O2/c1-2-18-5(17)3-4-6(9(11,12)13)15-8(14)16-7(4)10/h2-3H2,1H3,(H2,14,15,16) |
| InChIKey | JVBMSIRCXCXIBQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.64 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |