C16H23NO6S — CID 58283308
2-(2-methoxyethoxy)ethyl 4-(1,1-dioxo-1,4-thiazinan-4-yl)benzoate (PubChem CID 58283308) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 4-(1,1-dioxo-1,4-thiazinan-4-yl)benzoate.
| Compound Name | 2-(2-methoxyethoxy)ethyl 4-(1,1-dioxo-1,4-thiazinan-4-yl)benzoate |
|---|---|
| PubChem CID | 58283308 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 4-(1,1-dioxo-1,4-thiazinan-4-yl)benzoate |
| SMILES | COCCOCCOC(=O)c1ccc(N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C16H23NO6S/c1-21-8-9-22-10-11-23-16(18)14-2-4-15(5-3-14)17-6-12-24(19,20)13-7-17/h2-5H,6-13H2,1H3 |
| InChIKey | FXYPXEDKTWKRFS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|