C32H43N2O10P — CID 58283871
tert-butyl N-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-hydroxy-3-oxoheptoxy]-prop-2-enoxyphosphoryl]oxyethyl]carbamate (PubChem CID 58283871) has the molecular formula C32H43N2O10P and a molecular weight of 646.67 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-hydroxy-3-oxoheptoxy]-prop-2-enoxyphosphoryl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-hydroxy-3-oxoheptoxy]-prop-2-enoxyphosphoryl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 58283871 |
| Molecular Formula | C32H43N2O10P |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | tert-butyl N-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-hydroxy-3-oxoheptoxy]-prop-2-enoxyphosphoryl]oxyethyl]carbamate |
| SMILES | C=CCOP(=O)(OCCNC(=O)OC(C)(C)C)OCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)CCCCO |
| InChI | InChI=1S/C32H43N2O10P/c1-5-19-41-45(39,42-20-17-33-30(37)44-32(2,3)4)43-22-28(29(36)16-10-11-18-35)34-31(38)40-21-27-25-14-8-6-12-23(25)24-13-7-9-15-26(24)27/h5-9,12-15,27-28,35H,1,10-11,16-22H2,2-4H3,(H,33,37)(H,34,38) |
| InChIKey | IJGXULOWOBVQMD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|