C23H13ClFN3O3S — CID 58286083
(4E)-1-(4-chloro-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy(pyridin-3-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 58286083) has the molecular formula C23H13ClFN3O3S and a molecular weight of 465.89 g/mol. Its IUPAC name is (4E)-1-(4-chloro-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy(pyridin-3-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(4-chloro-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy(pyridin-3-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 58286083 |
| Molecular Formula | C23H13ClFN3O3S |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | (4E)-1-(4-chloro-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy(pyridin-3-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3c(Cl)cccc3s2)C(c2ccccc2F)/C1=C(\O)c1cccnc1 |
| InChI | InChI=1S/C23H13ClFN3O3S/c24-14-7-3-9-16-18(14)27-23(32-16)28-19(13-6-1-2-8-15(13)25)17(21(30)22(28)31)20(29)12-5-4-10-26-11-12/h1-11,19,29H/b20-17+ |
| InChIKey | GINWVXUVNSBNNP-LVZFUZTISA-N |
| XLogP | 5.11 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|