C68H94Cl2O6Ru — CID 58288917
CID 58288917 (PubChem CID 58288917) has the molecular formula C68H94Cl2O6Ru and a molecular weight of 1179.47 g/mol.
| Compound Name | CID 58288917 |
|---|---|
| PubChem CID | 58288917 |
| Molecular Formula | C68H94Cl2O6Ru |
| Molecular Weight | 1179.47 g/mol |
| Exact Mass | 1178.55 |
| IUPAC Name | — |
| SMILES | [CH3-].[CH]/C(C)=C/C/C(C)=C\C/C(C)=C\C/C(C)=C\C/C(C)=C\C/C(C)=C\C/C(C)=C\C/C(C)=C\C/C(C)=C\C/C(C)=C\Cc1cc(OC(=O)CC(=O)CC)c(C)c(C)c1OC(=O)CCc1ccc([OH+]C(C)C)c(C=[Ru](Cl)Cl)c1 |
| InChI | InChI=1S/C67H90O6.CH3.2ClH.Ru/c1-18-62(68)45-66(70)72-64-44-61(67(59(17)58(64)16)73-65(69)42-39-60-38-41-63(57(15)43-60)71-47(4)5)40-37-56(14)36-35-55(13)34-33-54(12)32-31-53(11)30-29-52(10)28-27-51(9)26-25-50(8)24-23-49(7)22-21-48(6)20-19-46(2)3;;;;/h2,15,19,21,23,25,27,29,31,33,35,37-38,41,43-44,47H,18,20,22,24,26,28,30,32,34,36,39-40,42,45H2,1,3-14,16-17H3;1H3;2*1H;/q;-1;;;+2/p-1/b46-19-,48-21-,49-23-,50-25-,51-27-,52-29-,53-31-,54-33-,55-35-,56-37-;;;; |
| InChIKey | ODOPPQCDNDPSIH-NSSGQPEESA-M |
| XLogP | 19.52 |
| TPSA | 82.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1179.47 |
| LogP ≤ 5 | 19.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|