C41H60O4 — CID 58289317
[17-[(E)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-[4-ethoxy-3-(hydroxymethyl)phenyl]prop-2-enoate (PubChem CID 58289317) has the molecular formula C41H60O4 and a molecular weight of 616.93 g/mol. Its IUPAC name is [17-[(E)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-[4-ethoxy-3-(hydroxymethyl)phenyl]prop-2-enoate.
| Compound Name | [17-[(E)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-[4-ethoxy-3-(hydroxymethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58289317 |
| Molecular Formula | C41H60O4 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.45 |
| IUPAC Name | [17-[(E)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-[4-ethoxy-3-(hydroxymethyl)phenyl]prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)OC2CCC3(C)C(=CCC4C3CCC3(C)C(C(C)/C=C/C(CC)C(C)C)CCC43)C2)cc1CO |
| InChI | InChI=1S/C41H60O4/c1-8-30(27(3)4)13-10-28(5)35-16-17-36-34-15-14-32-25-33(20-22-40(32,6)37(34)21-23-41(35,36)7)45-39(43)19-12-29-11-18-38(44-9-2)31(24-29)26-42/h10-14,18-19,24,27-28,30,33-37,42H,8-9,15-17,20-23,25-26H2,1-7H3/b13-10+,19-12+ |
| InChIKey | MVEJPWFEIGNJCW-STHKOIKCSA-N |
| XLogP | 9.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|