C20H27FN2O4 — CID 58292041
tert-butyl N-[1-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-4-oxocyclohexyl]carbamate (PubChem CID 58292041) has the molecular formula C20H27FN2O4 and a molecular weight of 378.44 g/mol. Its IUPAC name is tert-butyl N-[1-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-4-oxocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[1-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-4-oxocyclohexyl]carbamate |
|---|---|
| PubChem CID | 58292041 |
| Molecular Formula | C20H27FN2O4 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | tert-butyl N-[1-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-4-oxocyclohexyl]carbamate |
| SMILES | C[C@@H](NC(=O)C1(NC(=O)OC(C)(C)C)CCC(=O)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H27FN2O4/c1-13(14-5-7-15(21)8-6-14)22-17(25)20(11-9-16(24)10-12-20)23-18(26)27-19(2,3)4/h5-8,13H,9-12H2,1-4H3,(H,22,25)(H,23,26)/t13-/m1/s1 |
| InChIKey | JDDFVVHNXYBCJP-CYBMUJFWSA-N |
| XLogP | 3.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |